C18H12F4O4 — CID 1326489
3-(4-fluorophenoxy)-7-methoxy-8-methyl-2-(trifluoromethyl)chromen-4-one (PubChem CID 1326489) has the molecular formula C18H12F4O4 and a molecular weight of 368.28 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)-7-methoxy-8-methyl-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(4-fluorophenoxy)-7-methoxy-8-methyl-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 1326489 |
| Molecular Formula | C18H12F4O4 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-(4-fluorophenoxy)-7-methoxy-8-methyl-2-(trifluoromethyl)chromen-4-one |
| SMILES | COc1ccc2c(=O)c(Oc3ccc(F)cc3)c(C(F)(F)F)oc2c1C |
| InChI | InChI=1S/C18H12F4O4/c1-9-13(24-2)8-7-12-14(23)16(17(18(20,21)22)26-15(9)12)25-11-5-3-10(19)4-6-11/h3-8H,1-2H3 |
| InChIKey | PKHHCJREYFDCFB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |