C16H13N5S — CID 132648999
N-benzyl-2-cyano-2-(1H-imidazo[4,5-b]pyridin-2-yl)ethanethioamide (PubChem CID 132648999) has the molecular formula C16H13N5S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-benzyl-2-cyano-2-(1H-imidazo[4,5-b]pyridin-2-yl)ethanethioamide.
| Compound Name | N-benzyl-2-cyano-2-(1H-imidazo[4,5-b]pyridin-2-yl)ethanethioamide |
|---|---|
| PubChem CID | 132648999 |
| Molecular Formula | C16H13N5S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-benzyl-2-cyano-2-(1H-imidazo[4,5-b]pyridin-2-yl)ethanethioamide |
| SMILES | N#CC(C(=S)NCc1ccccc1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C16H13N5S/c17-9-12(14-20-13-7-4-8-18-15(13)21-14)16(22)19-10-11-5-2-1-3-6-11/h1-8,12H,10H2,(H,19,22)(H,18,20,21) |
| InChIKey | RSNZPVLWFFKNET-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|