C17H13Cl2NO5S — CID 1326871
ethyl 2-[2,6-dichloro-4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 1326871) has the molecular formula C17H13Cl2NO5S and a molecular weight of 414.27 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 1326871 |
| Molecular Formula | C17H13Cl2NO5S |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | C#CCN1C(=O)S/C(=C\c2cc(Cl)c(OCC(=O)OCC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H13Cl2NO5S/c1-3-5-20-16(22)13(26-17(20)23)8-10-6-11(18)15(12(19)7-10)25-9-14(21)24-4-2/h1,6-8H,4-5,9H2,2H3/b13-8- |
| InChIKey | BQENCIUJRQLYHS-JYRVWZFOSA-N |
| XLogP | 3.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|