About 2-bromopropanediamide
2-bromopropanediamide (PubChem CID 13271628) has the molecular formula C3H5BrN2O2
and a molecular weight of 180.99 g/mol. Its IUPAC name is 2-bromopropanediamide.
Molecular Properties
| Compound Name | 2-bromopropanediamide |
| PubChem CID | 13271628 |
| Molecular Formula | C3H5BrN2O2 |
| Molecular Weight | 180.99 g/mol |
| Exact Mass | 179.95 |
| IUPAC Name | 2-bromopropanediamide |
| SMILES | NC(=O)C(Br)C(N)=O |
| InChI | InChI=1S/C3H5BrN2O2/c4-1(2(5)7)3(6)8/h1H,(H2,5,7)(H2,6,8) |
| InChIKey | KDBUUJSOUXNTOE-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.99 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropanediamide?
The IUPAC name of 2-bromopropanediamide (CID 13271628) is 2-bromopropanediamide.
What is the SMILES notation for 2-bromopropanediamide?
The canonical SMILES for 2-bromopropanediamide is NC(=O)C(Br)C(N)=O.
What is the InChIKey of 2-bromopropanediamide?
The InChIKey is KDBUUJSOUXNTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrN2O2/c4-1(2(5)7)3(6)8/h1H,(H2,5,7)(H2,6,8).
What are the key properties of 2-bromopropanediamide?
2-bromopropanediamide has a molecular weight of 180.99 g/mol, XLogP of -1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropanediamide is sourced from PubChem (CID 13271628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).