C13H15O3- — CID 132775163
3-(3-formyl-2,4,6-trimethylphenyl)propanoate (PubChem CID 132775163) has the molecular formula C13H15O3- and a molecular weight of 219.26 g/mol. Its IUPAC name is 3-(3-formyl-2,4,6-trimethylphenyl)propanoate.
| Compound Name | 3-(3-formyl-2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 132775163 |
| Molecular Formula | C13H15O3- |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(3-formyl-2,4,6-trimethylphenyl)propanoate |
| SMILES | Cc1cc(C)c(CCC(=O)[O-])c(C)c1C=O |
| InChI | InChI=1S/C13H16O3/c1-8-6-9(2)12(7-14)10(3)11(8)4-5-13(15)16/h6-7H,4-5H2,1-3H3,(H,15,16)/p-1 |
| InChIKey | OVPHILBOFKEFHA-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|