C22H30FN3O4 — CID 132778658
1-(5-fluoro-2-pyridinyl)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]methyl]pyrrolidin-3-ol (PubChem CID 132778658) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 132778658 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]methyl]pyrrolidin-3-ol |
| SMILES | COCCOc1cc(CN(C)CC2(O)CCN(c3ccc(F)cn3)C2)ccc1OC |
| InChI | InChI=1S/C22H30FN3O4/c1-25(14-17-4-6-19(29-3)20(12-17)30-11-10-28-2)15-22(27)8-9-26(16-22)21-7-5-18(23)13-24-21/h4-7,12-13,27H,8-11,14-16H2,1-3H3 |
| InChIKey | BZZZAOMPBFNOFM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|