C54H50N4O7 — CID 132837505
5-hexoxy-1-N,3-N-bis[(2S)-3-hydroxy-1-oxo-1-(pyren-1-ylmethylamino)propan-2-yl]benzene-1,3-dicarboxamide (PubChem CID 132837505) has the molecular formula C54H50N4O7 and a molecular weight of 867.01 g/mol. Its IUPAC name is 5-hexoxy-1-N,3-N-bis[(2S)-3-hydroxy-1-oxo-1-(pyren-1-ylmethylamino)propan-2-yl]benzene-1,3-dicarboxamide.
| Compound Name | 5-hexoxy-1-N,3-N-bis[(2S)-3-hydroxy-1-oxo-1-(pyren-1-ylmethylamino)propan-2-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 132837505 |
| Molecular Formula | C54H50N4O7 |
| Molecular Weight | 867.01 g/mol |
| Exact Mass | 866.37 |
| IUPAC Name | 5-hexoxy-1-N,3-N-bis[(2S)-3-hydroxy-1-oxo-1-(pyren-1-ylmethylamino)propan-2-yl]benzene-1,3-dicarboxamide |
| SMILES | CCCCCCOc1cc(C(=O)N[C@@H](CO)C(=O)NCc2ccc3ccc4cccc5ccc2c3c45)cc(C(=O)N[C@@H](CO)C(=O)NCc2ccc3ccc4cccc5ccc2c3c45)c1 |
| InChI | InChI=1S/C54H50N4O7/c1-2-3-4-5-24-65-42-26-40(51(61)57-45(30-59)53(63)55-28-38-18-16-36-14-12-32-8-6-10-34-20-22-43(38)49(36)47(32)34)25-41(27-42)52(62)58-46(31-60)54(64)56-29-39-19-17-37-15-13-33-9-7-11-35-21-23-44(39)50(37)48(33)35/h6-23,25-27,45-46,59-60H,2-5,24,28-31H2,1H3,(H,55,63)(H,56,64)(H,57,61)(H,58,62)/t45-,46-/m0/s1 |
| InChIKey | SJFPMXYDLVRHPZ-ZYBCLOSLSA-N |
| XLogP | 8.25 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.01 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|