C56H52N6O7 — CID 132507544
1-N,3-N-bis[4-amino-1,4-dioxo-1-(pyren-1-ylmethylamino)butan-2-yl]-5-hexoxybenzene-1,3-dicarboxamide (PubChem CID 132507544) has the molecular formula C56H52N6O7 and a molecular weight of 921.07 g/mol. Its IUPAC name is 1-N,3-N-bis[4-amino-1,4-dioxo-1-(pyren-1-ylmethylamino)butan-2-yl]-5-hexoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-amino-1,4-dioxo-1-(pyren-1-ylmethylamino)butan-2-yl]-5-hexoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 132507544 |
| Molecular Formula | C56H52N6O7 |
| Molecular Weight | 921.07 g/mol |
| Exact Mass | 920.39 |
| IUPAC Name | 1-N,3-N-bis[4-amino-1,4-dioxo-1-(pyren-1-ylmethylamino)butan-2-yl]-5-hexoxybenzene-1,3-dicarboxamide |
| SMILES | CCCCCCOc1cc(C(=O)NC(CC(N)=O)C(=O)NCc2ccc3ccc4cccc5ccc2c3c45)cc(C(=O)NC(CC(N)=O)C(=O)NCc2ccc3ccc4cccc5ccc2c3c45)c1 |
| InChI | InChI=1S/C56H52N6O7/c1-2-3-4-5-24-69-42-26-40(53(65)61-45(28-47(57)63)55(67)59-30-38-18-16-36-14-12-32-8-6-10-34-20-22-43(38)51(36)49(32)34)25-41(27-42)54(66)62-46(29-48(58)64)56(68)60-31-39-19-17-37-15-13-33-9-7-11-35-21-23-44(39)52(37)50(33)35/h6-23,25-27,45-46H,2-5,24,28-31H2,1H3,(H2,57,63)(H2,58,64)(H,59,67)(H,60,68)(H,61,65)(H,62,66) |
| InChIKey | VGVCVYIPQKHNAA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 211.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.07 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|