C34H34N4O5 — CID 132820489
5-hexoxy-1-N,3-N-bis[(8-hydroxyquinolin-2-yl)methyl]benzene-1,3-dicarboxamide (PubChem CID 132820489) has the molecular formula C34H34N4O5 and a molecular weight of 578.67 g/mol. Its IUPAC name is 5-hexoxy-1-N,3-N-bis[(8-hydroxyquinolin-2-yl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-hexoxy-1-N,3-N-bis[(8-hydroxyquinolin-2-yl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 132820489 |
| Molecular Formula | C34H34N4O5 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 5-hexoxy-1-N,3-N-bis[(8-hydroxyquinolin-2-yl)methyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCCCOc1cc(C(=O)NCc2ccc3cccc(O)c3n2)cc(C(=O)NCc2ccc3cccc(O)c3n2)c1 |
| InChI | InChI=1S/C34H34N4O5/c1-2-3-4-5-16-43-28-18-24(33(41)35-20-26-14-12-22-8-6-10-29(39)31(22)37-26)17-25(19-28)34(42)36-21-27-15-13-23-9-7-11-30(40)32(23)38-27/h6-15,17-19,39-40H,2-5,16,20-21H2,1H3,(H,35,41)(H,36,42) |
| InChIKey | OLHUZEZOZATIJR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|