C47H47F2N3S5 — CID 132837689
4-[5-(3,6-difluoro-9-heptadecan-9-ylcarbazol-2-yl)thieno[3,2-b]thiophen-2-yl]-7-thieno[3,2-b]thiophen-5-yl-2,1,3-benzothiadiazole (PubChem CID 132837689) has the molecular formula C47H47F2N3S5 and a molecular weight of 852.24 g/mol. Its IUPAC name is 4-[5-(3,6-difluoro-9-heptadecan-9-ylcarbazol-2-yl)thieno[3,2-b]thiophen-2-yl]-7-thieno[3,2-b]thiophen-5-yl-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-(3,6-difluoro-9-heptadecan-9-ylcarbazol-2-yl)thieno[3,2-b]thiophen-2-yl]-7-thieno[3,2-b]thiophen-5-yl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 132837689 |
| Molecular Formula | C47H47F2N3S5 |
| Molecular Weight | 852.24 g/mol |
| Exact Mass | 851.23 |
| IUPAC Name | 4-[5-(3,6-difluoro-9-heptadecan-9-ylcarbazol-2-yl)thieno[3,2-b]thiophen-2-yl]-7-thieno[3,2-b]thiophen-5-yl-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2ccc(F)cc2c2cc(F)c(-c3cc4sc(-c5ccc(-c6cc7sccc7s6)c6nsnc56)cc4s3)cc21 |
| InChI | InChI=1S/C47H47F2N3S5/c1-3-5-7-9-11-13-15-30(16-14-12-10-8-6-4-2)52-37-20-17-29(48)23-33(37)34-24-36(49)35(25-38(34)52)42-28-45-44(56-42)27-41(55-45)32-19-18-31(46-47(32)51-57-50-46)40-26-43-39(54-40)21-22-53-43/h17-28,30H,3-16H2,1-2H3 |
| InChIKey | MLNHHKOXVJLJNR-UHFFFAOYSA-N |
| XLogP | 17.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.24 |
| LogP ≤ 5 | 17.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|