C21H36O6 — CID 132849660
[(3R)-3-(methoxymethoxy)undec-10-en-2-yl] (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 132849660) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is [(3R)-3-(methoxymethoxy)undec-10-en-2-yl] (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | [(3R)-3-(methoxymethoxy)undec-10-en-2-yl] (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 132849660 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | [(3R)-3-(methoxymethoxy)undec-10-en-2-yl] (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=CCCCCCC[C@@H](OCOC)C(C)OC(=O)[C@@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C21H36O6/c1-7-9-10-11-12-13-14-18(24-15-23-6)16(3)25-20(22)19-17(8-2)26-21(4,5)27-19/h7-8,16-19H,1-2,9-15H2,3-6H3/t16?,17-,18-,19-/m1/s1 |
| InChIKey | BRFBCFGZHGTNCC-VDFACSDUSA-N |
| XLogP | 4.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|