C20H38O5 — CID 71661809
(2S,3R,5S)-7-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,5-dimethylheptan-1-ol (PubChem CID 71661809) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is (2S,3R,5S)-7-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,5-dimethylheptan-1-ol.
| Compound Name | (2S,3R,5S)-7-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,5-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 71661809 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (2S,3R,5S)-7-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,5-dimethylheptan-1-ol |
| SMILES | C=CCC[C@@H]1OC(C)(C)O[C@H]1CC[C@H](C)C[C@@H](OCOC)[C@@H](C)CO |
| InChI | InChI=1S/C20H38O5/c1-7-8-9-17-18(25-20(4,5)24-17)11-10-15(2)12-19(16(3)13-21)23-14-22-6/h7,15-19,21H,1,8-14H2,2-6H3/t15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | HULCUZRLPZMNAZ-VPAKFMSCSA-N |
| XLogP | 3.90 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|