C15H13NO3S — CID 132850489
3-(benzenesulfonyl)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 132850489) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,3-dihydro-1H-quinolin-4-one.
| Compound Name | 3-(benzenesulfonyl)-2,3-dihydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 132850489 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-(benzenesulfonyl)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1c2ccccc2NCC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3S/c17-15-12-8-4-5-9-13(12)16-10-14(15)20(18,19)11-6-2-1-3-7-11/h1-9,14,16H,10H2 |
| InChIKey | RZCVEIZGACFQLH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |