C18H18N2O3 — CID 13285964
2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2-methylphenoxy]propanenitrile (PubChem CID 13285964) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2-methylphenoxy]propanenitrile.
| Compound Name | 2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2-methylphenoxy]propanenitrile |
|---|---|
| PubChem CID | 13285964 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2-methylphenoxy]propanenitrile |
| SMILES | Cc1ccc(N2C(=O)C3=C(CCCC3)C2=O)cc1OC(C)C#N |
| InChI | InChI=1S/C18H18N2O3/c1-11-7-8-13(9-16(11)23-12(2)10-19)20-17(21)14-5-3-4-6-15(14)18(20)22/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | QPXPXQXJEZVVDP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|