C22H26BrNO5 — CID 13290481
2-[4-bromo-3-[1-(2-methyl-1,3-dioxolan-2-yl)butoxy]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 13290481) has the molecular formula C22H26BrNO5 and a molecular weight of 464.36 g/mol. Its IUPAC name is 2-[4-bromo-3-[1-(2-methyl-1,3-dioxolan-2-yl)butoxy]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-bromo-3-[1-(2-methyl-1,3-dioxolan-2-yl)butoxy]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 13290481 |
| Molecular Formula | C22H26BrNO5 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[4-bromo-3-[1-(2-methyl-1,3-dioxolan-2-yl)butoxy]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC(Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Br)C1(C)OCCO1 |
| InChI | InChI=1S/C22H26BrNO5/c1-3-6-19(22(2)27-11-12-28-22)29-18-13-14(9-10-17(18)23)24-20(25)15-7-4-5-8-16(15)21(24)26/h9-10,13,19H,3-8,11-12H2,1-2H3 |
| InChIKey | UYSWXWRZTLVCMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|