C27H47NO3 — CID 132912845
trans-(2R,3R)-2-[7-(3,3-dimethylpiperidin-1-yl)-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one (PubChem CID 132912845) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is trans-(2R,3R)-2-[7-(3,3-dimethylpiperidin-1-yl)-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-[7-(3,3-dimethylpiperidin-1-yl)-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 132912845 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | trans-(2R,3R)-2-[7-(3,3-dimethylpiperidin-1-yl)-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC[C@H](O)C=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N1CCCC(C)(C)C1 |
| InChI | InChI=1S/C27H47NO3/c1-4-5-8-12-23(29)17-15-22-16-18-25(30)24(22)13-9-6-7-10-14-26(31)28-20-11-19-27(2,3)21-28/h15,17,22-24,29H,4-14,16,18-21H2,1-3H3/t22-,23-,24+/m0/s1 |
| InChIKey | KMQXDOWOGVSCSC-KMDXXIMOSA-N |
| XLogP | 6.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|