C26H12O6 — CID 132916040
4,13-dioxaheptacyclo[14.6.6.02,15.03,8.09,14.017,22.023,28]octacosa-2,6,8,10,14,17(22),19,23,25,27-decaene-5,12,18,21-tetrone (PubChem CID 132916040) has the molecular formula C26H12O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is 4,13-dioxaheptacyclo[14.6.6.02,15.03,8.09,14.017,22.023,28]octacosa-2,6,8,10,14,17(22),19,23,25,27-decaene-5,12,18,21-tetrone.
| Compound Name | 4,13-dioxaheptacyclo[14.6.6.02,15.03,8.09,14.017,22.023,28]octacosa-2,6,8,10,14,17(22),19,23,25,27-decaene-5,12,18,21-tetrone |
|---|---|
| PubChem CID | 132916040 |
| Molecular Formula | C26H12O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4,13-dioxaheptacyclo[14.6.6.02,15.03,8.09,14.017,22.023,28]octacosa-2,6,8,10,14,17(22),19,23,25,27-decaene-5,12,18,21-tetrone |
| SMILES | O=C1C=CC(=O)C2=C1C1c3ccccc3C2c2c1c1oc(=O)ccc1c1ccc(=O)oc21 |
| InChI | InChI=1S/C26H12O6/c27-15-7-8-16(28)22-20-12-4-2-1-3-11(12)19(21(15)22)23-24(20)26-14(6-10-18(30)32-26)13-5-9-17(29)31-25(13)23/h1-10,19-20H |
| InChIKey | JOKWRCMSRPHPJE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|