C44H80B6O12 — CID 132917901
4,4,5,5-tetramethyl-2-[1,1,7,8,8-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane (PubChem CID 132917901) has the molecular formula C44H80B6O12 and a molecular weight of 865.98 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1,1,7,8,8-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1,1,7,8,8-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132917901 |
| Molecular Formula | C44H80B6O12 |
| Molecular Weight | 865.98 g/mol |
| Exact Mass | 866.62 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1,1,7,8,8-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(CCCCC(B2OC(C)(C)C(C)(C)O2)=C(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)=C(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C44H80B6O12/c1-33(2)34(3,4)52-45(51-33)29(31(47-55-37(9,10)38(11,12)56-47)48-57-39(13,14)40(15,16)58-48)27-25-26-28-30(46-53-35(5,6)36(7,8)54-46)32(49-59-41(17,18)42(19,20)60-49)50-61-43(21,22)44(23,24)62-50/h25-28H2,1-24H3 |
| InChIKey | GFPKPGSLCUWQFK-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.98 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|