C20H26O3 — CID 132934751
[(1S,5R,6S)-4,4-dimethyl-6-prop-1-en-2-yl-3-oxabicyclo[3.2.1]octan-1-yl]methyl benzoate (PubChem CID 132934751) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is [(1S,5R,6S)-4,4-dimethyl-6-prop-1-en-2-yl-3-oxabicyclo[3.2.1]octan-1-yl]methyl benzoate.
| Compound Name | [(1S,5R,6S)-4,4-dimethyl-6-prop-1-en-2-yl-3-oxabicyclo[3.2.1]octan-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 132934751 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(1S,5R,6S)-4,4-dimethyl-6-prop-1-en-2-yl-3-oxabicyclo[3.2.1]octan-1-yl]methyl benzoate |
| SMILES | C=C(C)[C@H]1C[C@@]2(COC(=O)c3ccccc3)COC(C)(C)[C@@H]1C2 |
| InChI | InChI=1S/C20H26O3/c1-14(2)16-10-20(11-17(16)19(3,4)23-13-20)12-22-18(21)15-8-6-5-7-9-15/h5-9,16-17H,1,10-13H2,2-4H3/t16-,17-,20-/m1/s1 |
| InChIKey | AGCSDTJRDDXGBA-MBOZVWFJSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|