C8H10O9 — CID 132935836
2-[2-(carboxymethoxy)-2-oxoethoxy]-3-methoxy-3-oxopropanoic acid (PubChem CID 132935836) has the molecular formula C8H10O9 and a molecular weight of 250.16 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-2-oxoethoxy]-3-methoxy-3-oxopropanoic acid.
| Compound Name | 2-[2-(carboxymethoxy)-2-oxoethoxy]-3-methoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 132935836 |
| Molecular Formula | C8H10O9 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-[2-(carboxymethoxy)-2-oxoethoxy]-3-methoxy-3-oxopropanoic acid |
| SMILES | COC(=O)C(OCC(=O)OCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O9/c1-15-8(14)6(7(12)13)17-3-5(11)16-2-4(9)10/h6H,2-3H2,1H3,(H,9,10)(H,12,13) |
| InChIKey | BFWKFLJTQXBESJ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|