C9H14O10 — CID 20764466
2-[2-[2-(carboxymethylperoxy)ethoxymethoxy]acetyl]oxyacetic acid (PubChem CID 20764466) has the molecular formula C9H14O10 and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-[2-[2-(carboxymethylperoxy)ethoxymethoxy]acetyl]oxyacetic acid.
| Compound Name | 2-[2-[2-(carboxymethylperoxy)ethoxymethoxy]acetyl]oxyacetic acid |
|---|---|
| PubChem CID | 20764466 |
| Molecular Formula | C9H14O10 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[2-[2-(carboxymethylperoxy)ethoxymethoxy]acetyl]oxyacetic acid |
| SMILES | O=C(O)COOCCOCOCC(=O)OCC(=O)O |
| InChI | InChI=1S/C9H14O10/c10-7(11)3-17-9(14)5-16-6-15-1-2-18-19-4-8(12)13/h1-6H2,(H,10,11)(H,12,13) |
| InChIKey | GXLRGJDKVUSLFL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|