C73H51N5O2 — CID 132938132
ethyl 2-cyano-2-(5,7,8,10,15,17,18,20-octakis-phenyl-21,23-dihydroporphyrin-2-yl)acetate (PubChem CID 132938132) has the molecular formula C73H51N5O2 and a molecular weight of 1030.24 g/mol. Its IUPAC name is ethyl 2-cyano-2-(5,7,8,10,15,17,18,20-octakis-phenyl-21,23-dihydroporphyrin-2-yl)acetate.
| Compound Name | ethyl 2-cyano-2-(5,7,8,10,15,17,18,20-octakis-phenyl-21,23-dihydroporphyrin-2-yl)acetate |
|---|---|
| PubChem CID | 132938132 |
| Molecular Formula | C73H51N5O2 |
| Molecular Weight | 1030.24 g/mol |
| Exact Mass | 1029.40 |
| IUPAC Name | ethyl 2-cyano-2-(5,7,8,10,15,17,18,20-octakis-phenyl-21,23-dihydroporphyrin-2-yl)acetate |
| SMILES | CCOC(=O)C(C#N)c1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C(c2ccccc2)=C3c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C73H51N5O2/c1-2-80-73(79)56(46-74)55-45-59-62(49-31-15-5-16-32-49)71-64(51-35-19-7-20-36-51)63(50-33-17-6-18-34-50)69(77-71)60(47-27-11-3-12-28-47)57-43-44-58(75-57)61(48-29-13-4-14-30-48)70-65(52-37-21-8-22-38-52)66(53-39-23-9-24-40-53)72(78-70)67(68(55)76-59)54-41-25-10-26-42-54/h3-45,56,75-76H,2H2,1H3/b60-57-,61-58-,62-59-,68-67-,69-60-,70-61-,71-62-,72-67- |
| InChIKey | ZLJVPXHEFWLKRT-OSCPPMEXSA-N |
| XLogP | 17.17 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.24 |
| LogP ≤ 5 | 17.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|