C36H24F4N2 — CID 132966323
2,3,5,6-tetrakis[(E)-2-(4-fluorophenyl)ethenyl]pyrazine (PubChem CID 132966323) has the molecular formula C36H24F4N2 and a molecular weight of 560.59 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[(E)-2-(4-fluorophenyl)ethenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[(E)-2-(4-fluorophenyl)ethenyl]pyrazine |
|---|---|
| PubChem CID | 132966323 |
| Molecular Formula | C36H24F4N2 |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 2,3,5,6-tetrakis[(E)-2-(4-fluorophenyl)ethenyl]pyrazine |
| SMILES | Fc1ccc(/C=C/c2nc(/C=C/c3ccc(F)cc3)c(/C=C/c3ccc(F)cc3)nc2/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C36H24F4N2/c37-29-13-1-25(2-14-29)9-21-33-34(22-10-26-3-15-30(38)16-4-26)42-36(24-12-28-7-19-32(40)20-8-28)35(41-33)23-11-27-5-17-31(39)18-6-27/h1-24H/b21-9+,22-10+,23-11+,24-12+ |
| InChIKey | LXTZLPYBRMHQFT-DCLBUZTQSA-N |
| XLogP | 9.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |