C12H17NO2S — CID 132966578
[(3R,4S)-4-nitrohexan-3-yl]sulfanylbenzene (PubChem CID 132966578) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is [(3R,4S)-4-nitrohexan-3-yl]sulfanylbenzene.
| Compound Name | [(3R,4S)-4-nitrohexan-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 132966578 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | [(3R,4S)-4-nitrohexan-3-yl]sulfanylbenzene |
| SMILES | CC[C@@H](Sc1ccccc1)[C@H](CC)[N+](=O)[O-] |
| InChI | InChI=1S/C12H17NO2S/c1-3-11(13(14)15)12(4-2)16-10-8-6-5-7-9-10/h5-9,11-12H,3-4H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | KDDRQQBFAMAPGD-NWDGAFQWSA-N |
| XLogP | 3.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|