C16H14F3N3O3S — CID 132970325
N'-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]oxythiophene-3-carboximidamide (PubChem CID 132970325) has the molecular formula C16H14F3N3O3S and a molecular weight of 385.37 g/mol. Its IUPAC name is N'-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]oxythiophene-3-carboximidamide.
| Compound Name | N'-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]oxythiophene-3-carboximidamide |
|---|---|
| PubChem CID | 132970325 |
| Molecular Formula | C16H14F3N3O3S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N'-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]oxythiophene-3-carboximidamide |
| SMILES | N/C(=N\OC1CCN(c2cccc(OC(F)(F)F)c2)C1=O)c1ccsc1 |
| InChI | InChI=1S/C16H14F3N3O3S/c17-16(18,19)24-12-3-1-2-11(8-12)22-6-4-13(15(22)23)25-21-14(20)10-5-7-26-9-10/h1-3,5,7-9,13H,4,6H2,(H2,20,21) |
| InChIKey | RVTJHVXAPUTWJU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|