C10H12N2O4S2 — CID 13297629
ethyl 3-(4-formamido-2-methylsulfanyl-1,3-thiazol-5-yl)-3-oxopropanoate (PubChem CID 13297629) has the molecular formula C10H12N2O4S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 3-(4-formamido-2-methylsulfanyl-1,3-thiazol-5-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-(4-formamido-2-methylsulfanyl-1,3-thiazol-5-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 13297629 |
| Molecular Formula | C10H12N2O4S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | ethyl 3-(4-formamido-2-methylsulfanyl-1,3-thiazol-5-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1sc(SC)nc1NC=O |
| InChI | InChI=1S/C10H12N2O4S2/c1-3-16-7(15)4-6(14)8-9(11-5-13)12-10(17-2)18-8/h5H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | ITGWVPKSNRPNHC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|