C32H30N2O3 — CID 132990935
N-(2,3-dimethylphenyl)-1-(4,5,6-trimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine (PubChem CID 132990935) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-(4,5,6-trimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine.
| Compound Name | N-(2,3-dimethylphenyl)-1-(4,5,6-trimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine |
|---|---|
| PubChem CID | 132990935 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-(4,5,6-trimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine |
| SMILES | COc1c(OC)c(OC)c2c(-c3ccccc3)c(-c3ccccc3)[nH]c2c1/C=N/c1cccc(C)c1C |
| InChI | InChI=1S/C32H30N2O3/c1-20-13-12-18-25(21(20)2)33-19-24-29-27(31(36-4)32(37-5)30(24)35-3)26(22-14-8-6-9-15-22)28(34-29)23-16-10-7-11-17-23/h6-19,34H,1-5H3/b33-19+ |
| InChIKey | GMUQONZNZXUIHF-HNSNBQBZSA-N |
| XLogP | 7.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|