C29H23ClN2O2 — CID 132990983
N-(3-chlorophenyl)-1-(4,6-dimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine (PubChem CID 132990983) has the molecular formula C29H23ClN2O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-(4,6-dimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine.
| Compound Name | N-(3-chlorophenyl)-1-(4,6-dimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine |
|---|---|
| PubChem CID | 132990983 |
| Molecular Formula | C29H23ClN2O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-(3-chlorophenyl)-1-(4,6-dimethoxy-2,3-diphenyl-1H-indol-7-yl)methanimine |
| SMILES | COc1cc(OC)c2c(-c3ccccc3)c(-c3ccccc3)[nH]c2c1/C=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H23ClN2O2/c1-33-24-17-25(34-2)27-26(19-10-5-3-6-11-19)28(20-12-7-4-8-13-20)32-29(27)23(24)18-31-22-15-9-14-21(30)16-22/h3-18,32H,1-2H3/b31-18+ |
| InChIKey | NOFUDJRQECNVKL-FDAWAROLSA-N |
| XLogP | 7.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|