C28H20ClN3O — CID 46197105
4-chloro-2-phenyl-5,7-bis(phenyliminomethyl)-1H-indol-3-ol (PubChem CID 46197105) has the molecular formula C28H20ClN3O and a molecular weight of 449.94 g/mol. Its IUPAC name is 4-chloro-2-phenyl-5,7-bis(phenyliminomethyl)-1H-indol-3-ol.
| Compound Name | 4-chloro-2-phenyl-5,7-bis(phenyliminomethyl)-1H-indol-3-ol |
|---|---|
| PubChem CID | 46197105 |
| Molecular Formula | C28H20ClN3O |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 4-chloro-2-phenyl-5,7-bis(phenyliminomethyl)-1H-indol-3-ol |
| SMILES | Oc1c(-c2ccccc2)[nH]c2c(/C=N/c3ccccc3)cc(/C=N/c3ccccc3)c(Cl)c12 |
| InChI | InChI=1S/C28H20ClN3O/c29-25-20(17-30-22-12-6-2-7-13-22)16-21(18-31-23-14-8-3-9-15-23)26-24(25)28(33)27(32-26)19-10-4-1-5-11-19/h1-18,32-33H/b30-17+,31-18+ |
| InChIKey | MUHOVCPOYAEXTI-HRTPUDOWSA-N |
| XLogP | 7.70 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|