C29H44O3 — CID 132991391
(1'R,2R,4R,4'E,9'S)-7-methoxy-4',6,6,8,11',11'-hexamethyl-4-propan-2-ylspiro[3,4-dihydrochromene-2,8'-bicyclo[7.2.0]undec-4-ene]-5-one (PubChem CID 132991391) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is (1'R,2R,4R,4'E,9'S)-7-methoxy-4',6,6,8,11',11'-hexamethyl-4-propan-2-ylspiro[3,4-dihydrochromene-2,8'-bicyclo[7.2.0]undec-4-ene]-5-one.
| Compound Name | (1'R,2R,4R,4'E,9'S)-7-methoxy-4',6,6,8,11',11'-hexamethyl-4-propan-2-ylspiro[3,4-dihydrochromene-2,8'-bicyclo[7.2.0]undec-4-ene]-5-one |
|---|---|
| PubChem CID | 132991391 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (1'R,2R,4R,4'E,9'S)-7-methoxy-4',6,6,8,11',11'-hexamethyl-4-propan-2-ylspiro[3,4-dihydrochromene-2,8'-bicyclo[7.2.0]undec-4-ene]-5-one |
| SMILES | COC1=C(C)C2=C(C(=O)C1(C)C)[C@@H](C(C)C)C[C@@]1(CC/C=C(\C)CC[C@@H]3[C@@H]1CC3(C)C)O2 |
| InChI | InChI=1S/C29H44O3/c1-17(2)20-15-29(14-10-11-18(3)12-13-21-22(29)16-27(21,5)6)32-24-19(4)26(31-9)28(7,8)25(30)23(20)24/h11,17,20-22H,10,12-16H2,1-9H3/b18-11+/t20-,21-,22+,29-/m1/s1 |
| InChIKey | QRGTYZULVKDKCR-ZMENZXSCSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|