C17H16INOS — CID 133052544
2-(3-iodo-2-phenylsulfanylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 133052544) has the molecular formula C17H16INOS and a molecular weight of 409.29 g/mol. Its IUPAC name is 2-(3-iodo-2-phenylsulfanylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(3-iodo-2-phenylsulfanylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 133052544 |
| Molecular Formula | C17H16INOS |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 2-(3-iodo-2-phenylsulfanylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cccc(I)c2Sc2ccccc2)=N1 |
| InChI | InChI=1S/C17H16INOS/c1-17(2)11-20-16(19-17)13-9-6-10-14(18)15(13)21-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3 |
| InChIKey | YXNFWYUMRBFXJO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|