C11H12ClN — CID 133063265
5-chloro-1-methylspiro[2H-indole-3,1'-cyclopropane] (PubChem CID 133063265) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 5-chloro-1-methylspiro[2H-indole-3,1'-cyclopropane].
| Compound Name | 5-chloro-1-methylspiro[2H-indole-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 133063265 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-chloro-1-methylspiro[2H-indole-3,1'-cyclopropane] |
| SMILES | CN1CC2(CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H12ClN/c1-13-7-11(4-5-11)9-6-8(12)2-3-10(9)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | SDDNIRUBGDSKPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |