C19H21BrO — CID 133064100
(4R,5S)-5-benzyl-4-(4-bromophenyl)-2,2-dimethyloxolane (PubChem CID 133064100) has the molecular formula C19H21BrO and a molecular weight of 345.28 g/mol. Its IUPAC name is (4R,5S)-5-benzyl-4-(4-bromophenyl)-2,2-dimethyloxolane.
| Compound Name | (4R,5S)-5-benzyl-4-(4-bromophenyl)-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 133064100 |
| Molecular Formula | C19H21BrO |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4R,5S)-5-benzyl-4-(4-bromophenyl)-2,2-dimethyloxolane |
| SMILES | CC1(C)C[C@H](c2ccc(Br)cc2)[C@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H21BrO/c1-19(2)13-17(15-8-10-16(20)11-9-15)18(21-19)12-14-6-4-3-5-7-14/h3-11,17-18H,12-13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | FPMGXKJJCKRNSO-MSOLQXFVSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |