C11H23NO — CID 13307662
2-butyl-2,3-diethyl-1,3-oxazolidine (PubChem CID 13307662) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-butyl-2,3-diethyl-1,3-oxazolidine.
| Compound Name | 2-butyl-2,3-diethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 13307662 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2-butyl-2,3-diethyl-1,3-oxazolidine |
| SMILES | CCCCC1(CC)OCCN1CC |
| InChI | InChI=1S/C11H23NO/c1-4-7-8-11(5-2)12(6-3)9-10-13-11/h4-10H2,1-3H3 |
| InChIKey | ZNUWMDZKZRYPTF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |