C12H8Cl3NO2 — CID 133092417
6-(hydroxymethyl)-5-(3,4,5-trichlorophenyl)-1H-pyridin-2-one (PubChem CID 133092417) has the molecular formula C12H8Cl3NO2 and a molecular weight of 304.56 g/mol. Its IUPAC name is 6-(hydroxymethyl)-5-(3,4,5-trichlorophenyl)-1H-pyridin-2-one.
| Compound Name | 6-(hydroxymethyl)-5-(3,4,5-trichlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092417 |
| Molecular Formula | C12H8Cl3NO2 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 6-(hydroxymethyl)-5-(3,4,5-trichlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2cc(Cl)c(Cl)c(Cl)c2)c(CO)[nH]1 |
| InChI | InChI=1S/C12H8Cl3NO2/c13-8-3-6(4-9(14)12(8)15)7-1-2-11(18)16-10(7)5-17/h1-4,17H,5H2,(H,16,18) |
| InChIKey | INVUSICPYADHDG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|