C13H20N2O4S — CID 133111972
(3R,4S)-3-[benzylsulfamoyl(ethyl)amino]-4-hydroxyoxolane (PubChem CID 133111972) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is (3R,4S)-3-[benzylsulfamoyl(ethyl)amino]-4-hydroxyoxolane.
| Compound Name | (3R,4S)-3-[benzylsulfamoyl(ethyl)amino]-4-hydroxyoxolane |
|---|---|
| PubChem CID | 133111972 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (3R,4S)-3-[benzylsulfamoyl(ethyl)amino]-4-hydroxyoxolane |
| SMILES | CCN([C@@H]1COC[C@H]1O)S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-2-15(12-9-19-10-13(12)16)20(17,18)14-8-11-6-4-3-5-7-11/h3-7,12-14,16H,2,8-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | LRAKTYSJXLAWDH-CHWSQXEVSA-N |
| XLogP | 0.10 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |