C21H23N3O3S — CID 133118876
(3R,4R)-1-(benzenesulfonyl)-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-3-ol (PubChem CID 133118876) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is (3R,4R)-1-(benzenesulfonyl)-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-(benzenesulfonyl)-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 133118876 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (3R,4R)-1-(benzenesulfonyl)-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccccc1)N1C[C@@H](O)[C@H](N2CCc3[nH]c4ccccc4c3C2)C1 |
| InChI | InChI=1S/C21H23N3O3S/c25-21-14-24(28(26,27)15-6-2-1-3-7-15)13-20(21)23-11-10-19-17(12-23)16-8-4-5-9-18(16)22-19/h1-9,20-22,25H,10-14H2/t20-,21-/m1/s1 |
| InChIKey | AAPWFTRMMDGGGF-NHCUHLMSSA-N |
| XLogP | 1.96 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|