C17H27N5O3S — CID 133128857
1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one (PubChem CID 133128857) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 133128857 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one |
| SMILES | CC(C)=CCN1CCN(C(=O)CCc2n[nH]c(C)n2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H27N5O3S/c1-12(2)6-7-21-8-9-22(15-11-26(24,25)10-14(15)21)17(23)5-4-16-18-13(3)19-20-16/h6,14-15H,4-5,7-11H2,1-3H3,(H,18,19,20)/t14-,15+/m0/s1 |
| InChIKey | IDEDFABOWBFOOD-LSDHHAIUSA-N |
| XLogP | 0.32 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|