C17H26N6O — CID 133137064
(3aS,7aR)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 133137064) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is (3aS,7aR)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aS,7aR)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 133137064 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (3aS,7aR)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | NC(=O)N1C[C@@H]2CCCC(N3CCN(c4ncccn4)CC3)[C@@H]2C1 |
| InChI | InChI=1S/C17H26N6O/c18-16(24)23-11-13-3-1-4-15(14(13)12-23)21-7-9-22(10-8-21)17-19-5-2-6-20-17/h2,5-6,13-15H,1,3-4,7-12H2,(H2,18,24)/t13-,14+,15?/m0/s1 |
| InChIKey | GOEQKUBASCMQMU-SNTRVMSOSA-N |
| XLogP | 0.78 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |