C13H18N4O2 — CID 80997460
2-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid (PubChem CID 80997460) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 80997460 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H18N4O2/c18-12(19)10-2-3-11(10)16-6-8-17(9-7-16)13-14-4-1-5-15-13/h1,4-5,10-11H,2-3,6-9H2,(H,18,19) |
| InChIKey | CCILXACPZQUGBM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |