C14H21N5O — CID 87785998
(2S,3R,4S)-3-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2-carbaldehyde (PubChem CID 87785998) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is (2S,3R,4S)-3-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2-carbaldehyde.
| Compound Name | (2S,3R,4S)-3-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 87785998 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (2S,3R,4S)-3-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2-carbaldehyde |
| SMILES | C[C@H]1[C@H](N2CCN(c3ncccn3)CC2)CN[C@@H]1C=O |
| InChI | InChI=1S/C14H21N5O/c1-11-12(10-20)17-9-13(11)18-5-7-19(8-6-18)14-15-3-2-4-16-14/h2-4,10-13,17H,5-9H2,1H3/t11-,12-,13-/m1/s1 |
| InChIKey | BFWZHLQRYVYJLN-JHJVBQTASA-N |
| XLogP | -0.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|