C17H20N2O2S — CID 133142739
(2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 133142739) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 133142739 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | c1cc(CN2C[C@H]3C[C@H](c4nc(C5CC5)cs4)O[C@H]3C2)co1 |
| InChI | InChI=1S/C17H20N2O2S/c1-2-12(1)14-10-22-17(18-14)15-5-13-7-19(8-16(13)21-15)6-11-3-4-20-9-11/h3-4,9-10,12-13,15-16H,1-2,5-8H2/t13-,15-,16+/m1/s1 |
| InChIKey | KMDYNVPVVVXHQI-BMFZPTHFSA-N |
| XLogP | 3.58 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |