C25H30N4O2S — CID 133156157
1-(4-ethoxyphenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156157) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-ethoxyphenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156157 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-(4-ethoxyphenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(CCOC)c2C)cc1 |
| InChI | InChI=1S/C25H30N4O2S/c1-5-31-20-11-9-19(10-12-20)29-24(21-16-17(2)28(18(21)3)14-15-30-4)23(27-25(29)32)22-8-6-7-13-26-22/h6-13,16,23-24H,5,14-15H2,1-4H3,(H,27,32) |
| InChIKey | IYJVAJHEOOBTPJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|