C23H27ClN4O4S — CID 133163745
2-[4-(butan-2-ylsulfamoyl)phenoxy]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide (PubChem CID 133163745) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is 2-[4-(butan-2-ylsulfamoyl)phenoxy]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-[4-(butan-2-ylsulfamoyl)phenoxy]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 133163745 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[4-(butan-2-ylsulfamoyl)phenoxy]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(OCC(=O)NCCNc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C23H27ClN4O4S/c1-3-16(2)28-33(30,31)19-7-5-18(6-8-19)32-15-23(29)27-13-12-26-21-10-11-25-22-14-17(24)4-9-20(21)22/h4-11,14,16,28H,3,12-13,15H2,1-2H3,(H,25,26)(H,27,29) |
| InChIKey | ZUUNKEIXLTXMLW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|