C18H20N2O4 — CID 133179478
N-[(E)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]-3-methylfuran-2-carboxamide (PubChem CID 133179478) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[(E)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]-3-methylfuran-2-carboxamide.
| Compound Name | N-[(E)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 133179478 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[(E)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)N/N=C/c1ccc2c(c1)OCC(C)(C)CO2 |
| InChI | InChI=1S/C18H20N2O4/c1-12-6-7-22-16(12)17(21)20-19-9-13-4-5-14-15(8-13)24-11-18(2,3)10-23-14/h4-9H,10-11H2,1-3H3,(H,20,21)/b19-9+ |
| InChIKey | HVZRHVDGDIISAM-DJKKODMXSA-N |
| XLogP | 3.15 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|