C23H19N5O3S — CID 133180963
1-(furan-2-ylmethyl)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133180963) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(furan-2-ylmethyl)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133180963 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | O=[N+]([O-])c1cccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2Cc2ccco2)c1 |
| InChI | InChI=1S/C23H19N5O3S/c29-28(30)17-7-3-6-16(14-17)26-12-4-10-20(26)22-21(19-9-1-2-11-24-19)25-23(32)27(22)15-18-8-5-13-31-18/h1-14,21-22H,15H2,(H,25,32) |
| InChIKey | VEFOHXYIFVFNCN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|