C26H23N3OS2 — CID 133183500
1-[4-(2-methylphenoxy)phenyl]-5-(3-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183500) has the molecular formula C26H23N3OS2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-[4-(2-methylphenoxy)phenyl]-5-(3-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[4-(2-methylphenoxy)phenyl]-5-(3-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183500 |
| Molecular Formula | C26H23N3OS2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 1-[4-(2-methylphenoxy)phenyl]-5-(3-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccccc1Oc1ccc(N2C(=S)NC(c3ccccn3)C2c2sccc2C)cc1 |
| InChI | InChI=1S/C26H23N3OS2/c1-17-7-3-4-9-22(17)30-20-12-10-19(11-13-20)29-24(25-18(2)14-16-32-25)23(28-26(29)31)21-8-5-6-15-27-21/h3-16,23-24H,1-2H3,(H,28,31) |
| InChIKey | KPJBJFCEZBHDNO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|