C25H22N4OS — CID 133183674
1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1H-pyrrol-2-yl)imidazolidine-2-thione (PubChem CID 133183674) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1H-pyrrol-2-yl)imidazolidine-2-thione.
| Compound Name | 1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1H-pyrrol-2-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133183674 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1H-pyrrol-2-yl)imidazolidine-2-thione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc[nH]3)cc2)cc1 |
| InChI | InChI=1S/C25H22N4OS/c1-17-7-11-19(12-8-17)30-20-13-9-18(10-14-20)29-24(22-6-4-16-27-22)23(28-25(29)31)21-5-2-3-15-26-21/h2-16,23-24,27H,1H3,(H,28,31) |
| InChIKey | GGSQFAZZJXQCOE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|