C33H35FN6O2S — CID 133208918
3-[5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 133208918) has the molecular formula C33H35FN6O2S and a molecular weight of 598.75 g/mol. Its IUPAC name is 3-[5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 133208918 |
| Molecular Formula | C33H35FN6O2S |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | 3-[5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c(C)n1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C33H35FN6O2S/c1-22-21-26(23(2)40(22)25-12-10-24(11-13-25)38-17-19-42-20-18-38)32-31(29-9-5-6-15-35-29)37-33(43)39(32)16-14-30(41)36-28-8-4-3-7-27(28)34/h3-13,15,21,31-32H,14,16-20H2,1-2H3,(H,36,41)(H,37,43) |
| InChIKey | SCBAGXVSDLXYTN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|