C15H20Cl2N2O4 — CID 133266871
1-[(2,4-dichlorophenyl)methyl]-3-[(3S,4R)-4-(2-hydroxyethoxy)oxan-3-yl]urea (PubChem CID 133266871) has the molecular formula C15H20Cl2N2O4 and a molecular weight of 363.24 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[(3S,4R)-4-(2-hydroxyethoxy)oxan-3-yl]urea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[(3S,4R)-4-(2-hydroxyethoxy)oxan-3-yl]urea |
|---|---|
| PubChem CID | 133266871 |
| Molecular Formula | C15H20Cl2N2O4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[(3S,4R)-4-(2-hydroxyethoxy)oxan-3-yl]urea |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)N[C@H]1COCC[C@H]1OCCO |
| InChI | InChI=1S/C15H20Cl2N2O4/c16-11-2-1-10(12(17)7-11)8-18-15(21)19-13-9-22-5-3-14(13)23-6-4-20/h1-2,7,13-14,20H,3-6,8-9H2,(H2,18,19,21)/t13-,14+/m0/s1 |
| InChIKey | OKOQRTCXTXDNEC-UONOGXRCSA-N |
| XLogP | 1.96 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |